C19H17F2N3O2 — CID 176718672
ethyl 5-[5-fluoro-3-(5-fluoro-3-pyridinyl)-2-pyridinyl]-1,2-dimethylpyrrole-3-carboxylate (PubChem CID 176718672) has the molecular formula C19H17F2N3O2 and a molecular weight of 357.36 g/mol. Its IUPAC name is ethyl 5-[5-fluoro-3-(5-fluoro-3-pyridinyl)-2-pyridinyl]-1,2-dimethylpyrrole-3-carboxylate.
| Compound Name | ethyl 5-[5-fluoro-3-(5-fluoro-3-pyridinyl)-2-pyridinyl]-1,2-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 176718672 |
| Molecular Formula | C19H17F2N3O2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | ethyl 5-[5-fluoro-3-(5-fluoro-3-pyridinyl)-2-pyridinyl]-1,2-dimethylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ncc(F)cc2-c2cncc(F)c2)n(C)c1C |
| InChI | InChI=1S/C19H17F2N3O2/c1-4-26-19(25)15-7-17(24(3)11(15)2)18-16(6-14(21)10-23-18)12-5-13(20)9-22-8-12/h5-10H,4H2,1-3H3 |
| InChIKey | LCNXWFWCLGJXIS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|