C14H10ClF2NO2 — CID 77174619
ethyl 5-chloro-2-(2,4-difluorophenyl)pyridine-3-carboxylate (PubChem CID 77174619) has the molecular formula C14H10ClF2NO2 and a molecular weight of 297.69 g/mol. Its IUPAC name is ethyl 5-chloro-2-(2,4-difluorophenyl)pyridine-3-carboxylate.
| Compound Name | ethyl 5-chloro-2-(2,4-difluorophenyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 77174619 |
| Molecular Formula | C14H10ClF2NO2 |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | ethyl 5-chloro-2-(2,4-difluorophenyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cl)cnc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C14H10ClF2NO2/c1-2-20-14(19)11-5-8(15)7-18-13(11)10-4-3-9(16)6-12(10)17/h3-7H,2H2,1H3 |
| InChIKey | IGLRLPJXAOPCLY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |