About ethyl 3-(2,4-difluorophenyl)-1,2,4-oxadiazole-5-carboxylate
ethyl 3-(2,4-difluorophenyl)-1,2,4-oxadiazole-5-carboxylate (PubChem CID 67454300) has the molecular formula C11H8F2N2O3
and a molecular weight of 254.19 g/mol. Its IUPAC name is ethyl 3-(2,4-difluorophenyl)-1,2,4-oxadiazole-5-carboxylate.
Analyze ethyl 3-(2,4-difluorophenyl)-1,2,4-oxadiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2,4-difluorophenyl)-1,2,4-oxadiazole-5-carboxylate?
The IUPAC name of ethyl 3-(2,4-difluorophenyl)-1,2,4-oxadiazole-5-carboxylate (CID 67454300) is ethyl 3-(2,4-difluorophenyl)-1,2,4-oxadiazole-5-carboxylate.
What is the SMILES notation for ethyl 3-(2,4-difluorophenyl)-1,2,4-oxadiazole-5-carboxylate?
The canonical SMILES for ethyl 3-(2,4-difluorophenyl)-1,2,4-oxadiazole-5-carboxylate is CCOC(=O)c1nc(-c2ccc(F)cc2F)no1.
What is the InChIKey of ethyl 3-(2,4-difluorophenyl)-1,2,4-oxadiazole-5-carboxylate?
The InChIKey is GLPZMXFBKJTPSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F2N2O3/c1-2-17-11(16)10-14-9(15-18-10)7-4-3-6(12)5-8(7)13/h3-5H,2H2,1H3.
What are the key properties of ethyl 3-(2,4-difluorophenyl)-1,2,4-oxadiazole-5-carboxylate?
ethyl 3-(2,4-difluorophenyl)-1,2,4-oxadiazole-5-carboxylate has a molecular weight of 254.19 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2,4-difluorophenyl)-1,2,4-oxadiazole-5-carboxylate is sourced from PubChem (CID 67454300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).