C11H8Cl2N2O3 — CID 107917947
ethyl 3-(3,5-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylate (PubChem CID 107917947) has the molecular formula C11H8Cl2N2O3 and a molecular weight of 287.10 g/mol. Its IUPAC name is ethyl 3-(3,5-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylate.
| Compound Name | ethyl 3-(3,5-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylate |
|---|---|
| PubChem CID | 107917947 |
| Molecular Formula | C11H8Cl2N2O3 |
| Molecular Weight | 287.10 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | ethyl 3-(3,5-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cc(Cl)cc(Cl)c2)no1 |
| InChI | InChI=1S/C11H8Cl2N2O3/c1-2-17-11(16)10-14-9(15-18-10)6-3-7(12)5-8(13)4-6/h3-5H,2H2,1H3 |
| InChIKey | SYMUOCCNIWIALM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.10 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |