C9H8O4 — CID 176721372
(6R)-10-hydroxy-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 176721372) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is (6R)-10-hydroxy-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (6R)-10-hydroxy-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 176721372 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | (6R)-10-hydroxy-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1OC(=O)[C@@H]2C3C=CC(C3O)C12 |
| InChI | InChI=1S/C9H8O4/c10-7-3-1-2-4(7)6-5(3)8(11)13-9(6)12/h1-7,10H/t3?,4?,5-,6?,7?/m1/s1 |
| InChIKey | QDTXFJMDGQJMCS-BQHSNLCNSA-N |
| XLogP | -0.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|