C12H14O5 — CID 577275
9-hydroxytricyclo[5.2.1.04,10]dec-5-ene-2,3-dicarboxylic acid (PubChem CID 577275) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is 9-hydroxytricyclo[5.2.1.04,10]dec-5-ene-2,3-dicarboxylic acid.
| Compound Name | 9-hydroxytricyclo[5.2.1.04,10]dec-5-ene-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 577275 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 9-hydroxytricyclo[5.2.1.04,10]dec-5-ene-2,3-dicarboxylic acid |
| SMILES | O=C(O)C1C2C=CC3CC(O)C(C1C(=O)O)C32 |
| InChI | InChI=1S/C12H14O5/c13-6-3-4-1-2-5-7(4)9(6)10(12(16)17)8(5)11(14)15/h1-2,4-10,13H,3H2,(H,14,15)(H,16,17) |
| InChIKey | TUIJFFVEYZVFNO-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|