C17H26O5 — CID 70526541
methyl (3aR,4S,5S,6aR)-4-(8-hydroxyoct-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate (PubChem CID 70526541) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl (3aR,4S,5S,6aR)-4-(8-hydroxyoct-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate.
| Compound Name | methyl (3aR,4S,5S,6aR)-4-(8-hydroxyoct-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate |
|---|---|
| PubChem CID | 70526541 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | methyl (3aR,4S,5S,6aR)-4-(8-hydroxyoct-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2OC(=O)C[C@@H]2[C@@H]1C=CCCCCCCO |
| InChI | InChI=1S/C17H26O5/c1-21-17(20)14-10-15-13(11-16(19)22-15)12(14)8-6-4-2-3-5-7-9-18/h6,8,12-15,18H,2-5,7,9-11H2,1H3/t12-,13+,14-,15+/m0/s1 |
| InChIKey | ZVRMDWHLVMQGTK-LJISPDSOSA-N |
| XLogP | 2.23 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|