C22H33N9O — CID 176723611
2-[3-[(7R,8aS)-7-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-methoxypyrimidin-4-yl]azetidin-3-yl]acetonitrile (PubChem CID 176723611) has the molecular formula C22H33N9O and a molecular weight of 439.57 g/mol. Its IUPAC name is 2-[3-[(7R,8aS)-7-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-methoxypyrimidin-4-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[3-[(7R,8aS)-7-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-methoxypyrimidin-4-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 176723611 |
| Molecular Formula | C22H33N9O |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | 2-[3-[(7R,8aS)-7-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-methoxypyrimidin-4-yl]azetidin-3-yl]acetonitrile |
| SMILES | C/N=C/C(=C\N)Nc1ncc(OC)c(N2CC(CC#N)(N3CCN4C[C@H](C)C[C@H]4C3)C2)n1 |
| InChI | InChI=1S/C22H33N9O/c1-16-8-18-13-31(7-6-29(18)12-16)22(4-5-23)14-30(15-22)20-19(32-3)11-26-21(28-20)27-17(9-24)10-25-2/h9-11,16,18H,4,6-8,12-15,24H2,1-3H3,(H,26,27,28)/b17-9+,25-10+/t16-,18+/m1/s1 |
| InChIKey | RAALENXXVWRDFW-CSIBSMOKSA-N |
| XLogP | 0.90 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|