C21H31N9O2 — CID 176723749
2-[3-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-methoxypyrimidin-4-yl]azetidin-3-yl]acetonitrile (PubChem CID 176723749) has the molecular formula C21H31N9O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 2-[3-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-methoxypyrimidin-4-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[3-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-methoxypyrimidin-4-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 176723749 |
| Molecular Formula | C21H31N9O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 2-[3-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-methoxypyrimidin-4-yl]azetidin-3-yl]acetonitrile |
| SMILES | C/N=C/C(=C\N)Nc1ncc(OC)c(N2CC(CC#N)(N3CCN4CCOC[C@H]4C3)C2)n1 |
| InChI | InChI=1S/C21H31N9O2/c1-24-10-16(9-23)26-20-25-11-18(31-2)19(27-20)29-14-21(15-29,3-4-22)30-6-5-28-7-8-32-13-17(28)12-30/h9-11,17H,3,5-8,12-15,23H2,1-2H3,(H,25,26,27)/b16-9+,24-10+/t17-/m1/s1 |
| InChIKey | LPWRWDXENDBTGZ-FDHDXBOLSA-N |
| XLogP | -0.11 |
| TPSA | 128.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|