C21H30FN9 — CID 176723724
2-[3-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-fluoropyrimidin-4-yl]azetidin-3-yl]acetonitrile (PubChem CID 176723724) has the molecular formula C21H30FN9 and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-[3-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-fluoropyrimidin-4-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[3-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-fluoropyrimidin-4-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 176723724 |
| Molecular Formula | C21H30FN9 |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 2-[3-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-fluoropyrimidin-4-yl]azetidin-3-yl]acetonitrile |
| SMILES | C/N=C/C(=C\N)Nc1ncc(F)c(N2CC(CC#N)(N3CCN4CCCC[C@H]4C3)C2)n1 |
| InChI | InChI=1S/C21H30FN9/c1-25-11-16(10-24)27-20-26-12-18(22)19(28-20)30-14-21(15-30,5-6-23)31-9-8-29-7-3-2-4-17(29)13-31/h10-12,17H,2-5,7-9,13-15,24H2,1H3,(H,26,27,28)/b16-10+,25-11+/t17-/m0/s1 |
| InChIKey | AOPASGPGIDYRFV-ZEJRONCJSA-N |
| XLogP | 1.17 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|