C12H11BNO5 — CID 176726090
CID 176726090 (PubChem CID 176726090) has the molecular formula C12H11BNO5 and a molecular weight of 260.03 g/mol.
| Compound Name | CID 176726090 |
|---|---|
| PubChem CID | 176726090 |
| Molecular Formula | C12H11BNO5 |
| Molecular Weight | 260.03 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | — |
| SMILES | O=C(O)C(=O)N[C@H]([B]O)Cc1coc2ccccc12 |
| InChI | InChI=1S/C12H11BNO5/c15-11(12(16)17)14-10(13-18)5-7-6-19-9-4-2-1-3-8(7)9/h1-4,6,10,18H,5H2,(H,14,15)(H,16,17)/t10-/m0/s1 |
| InChIKey | QCKFKOJHMGJBSC-JTQLQIEISA-N |
| XLogP | 0.11 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.03 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|