C23H27FN2O2 — CID 176727609
(5-ethynyl-6-fluoro-4-propan-2-ylnaphthalen-2-yl) N-methyl-N-(piperidin-2-ylmethyl)carbamate (PubChem CID 176727609) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is (5-ethynyl-6-fluoro-4-propan-2-ylnaphthalen-2-yl) N-methyl-N-(piperidin-2-ylmethyl)carbamate.
| Compound Name | (5-ethynyl-6-fluoro-4-propan-2-ylnaphthalen-2-yl) N-methyl-N-(piperidin-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 176727609 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (5-ethynyl-6-fluoro-4-propan-2-ylnaphthalen-2-yl) N-methyl-N-(piperidin-2-ylmethyl)carbamate |
| SMILES | C#Cc1c(F)ccc2cc(OC(=O)N(C)CC3CCCCN3)cc(C(C)C)c12 |
| InChI | InChI=1S/C23H27FN2O2/c1-5-19-21(24)10-9-16-12-18(13-20(15(2)3)22(16)19)28-23(27)26(4)14-17-8-6-7-11-25-17/h1,9-10,12-13,15,17,25H,6-8,11,14H2,2-4H3 |
| InChIKey | ZDHOSRRRIXFLLG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|