C22H25FN2O2 — CID 176727794
(5-ethynyl-6-fluoro-4-propan-2-ylnaphthalen-2-yl) N-methyl-N-[[(2S)-pyrrolidin-2-yl]methyl]carbamate (PubChem CID 176727794) has the molecular formula C22H25FN2O2 and a molecular weight of 368.45 g/mol. Its IUPAC name is (5-ethynyl-6-fluoro-4-propan-2-ylnaphthalen-2-yl) N-methyl-N-[[(2S)-pyrrolidin-2-yl]methyl]carbamate.
| Compound Name | (5-ethynyl-6-fluoro-4-propan-2-ylnaphthalen-2-yl) N-methyl-N-[[(2S)-pyrrolidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 176727794 |
| Molecular Formula | C22H25FN2O2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (5-ethynyl-6-fluoro-4-propan-2-ylnaphthalen-2-yl) N-methyl-N-[[(2S)-pyrrolidin-2-yl]methyl]carbamate |
| SMILES | C#Cc1c(F)ccc2cc(OC(=O)N(C)C[C@@H]3CCCN3)cc(C(C)C)c12 |
| InChI | InChI=1S/C22H25FN2O2/c1-5-18-20(23)9-8-15-11-17(12-19(14(2)3)21(15)18)27-22(26)25(4)13-16-7-6-10-24-16/h1,8-9,11-12,14,16,24H,6-7,10,13H2,2-4H3/t16-/m0/s1 |
| InChIKey | FLFMKNBKEPSZDB-INIZCTEOSA-N |
| XLogP | 4.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|