C21H26N6O3 — CID 176729313
2-tert-butyl-4-(8-methoxypyrimido[4,5-c][1,8]naphthyridin-1-yl)-1,4-diazepane-1-carboxylic acid (PubChem CID 176729313) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is 2-tert-butyl-4-(8-methoxypyrimido[4,5-c][1,8]naphthyridin-1-yl)-1,4-diazepane-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-(8-methoxypyrimido[4,5-c][1,8]naphthyridin-1-yl)-1,4-diazepane-1-carboxylic acid |
|---|---|
| PubChem CID | 176729313 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-tert-butyl-4-(8-methoxypyrimido[4,5-c][1,8]naphthyridin-1-yl)-1,4-diazepane-1-carboxylic acid |
| SMILES | COc1ccc2c(ncc3ncnc(N4CCCN(C(=O)O)C(C(C)(C)C)C4)c32)n1 |
| InChI | InChI=1S/C21H26N6O3/c1-21(2,3)15-11-26(8-5-9-27(15)20(28)29)19-17-13-6-7-16(30-4)25-18(13)22-10-14(17)23-12-24-19/h6-7,10,12,15H,5,8-9,11H2,1-4H3,(H,28,29) |
| InChIKey | NHKYIKGZIGOIAG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|