C21H27N7O5S — CID 172548694
tert-butyl N-[[4-(8-methoxypyrimido[4,5-c][1,8]naphthyridin-1-yl)-1,4-diazepan-1-yl]sulfonyl]carbamate (PubChem CID 172548694) has the molecular formula C21H27N7O5S and a molecular weight of 489.56 g/mol. Its IUPAC name is tert-butyl N-[[4-(8-methoxypyrimido[4,5-c][1,8]naphthyridin-1-yl)-1,4-diazepan-1-yl]sulfonyl]carbamate.
| Compound Name | tert-butyl N-[[4-(8-methoxypyrimido[4,5-c][1,8]naphthyridin-1-yl)-1,4-diazepan-1-yl]sulfonyl]carbamate |
|---|---|
| PubChem CID | 172548694 |
| Molecular Formula | C21H27N7O5S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | tert-butyl N-[[4-(8-methoxypyrimido[4,5-c][1,8]naphthyridin-1-yl)-1,4-diazepan-1-yl]sulfonyl]carbamate |
| SMILES | COc1ccc2c(ncc3ncnc(N4CCCN(S(=O)(=O)NC(=O)OC(C)(C)C)CC4)c32)n1 |
| InChI | InChI=1S/C21H27N7O5S/c1-21(2,3)33-20(29)26-34(30,31)28-9-5-8-27(10-11-28)19-17-14-6-7-16(32-4)25-18(14)22-12-15(17)23-13-24-19/h6-7,12-13H,5,8-11H2,1-4H3,(H,26,29) |
| InChIKey | SOAQZHPBOPBZNJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|