C11H17N5O4S — CID 114461595
methyl N-[4-(3-amino-2-pyridinyl)piperazin-1-yl]sulfonylcarbamate (PubChem CID 114461595) has the molecular formula C11H17N5O4S and a molecular weight of 315.36 g/mol. Its IUPAC name is methyl N-[4-(3-amino-2-pyridinyl)piperazin-1-yl]sulfonylcarbamate.
| Compound Name | methyl N-[4-(3-amino-2-pyridinyl)piperazin-1-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 114461595 |
| Molecular Formula | C11H17N5O4S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | methyl N-[4-(3-amino-2-pyridinyl)piperazin-1-yl]sulfonylcarbamate |
| SMILES | COC(=O)NS(=O)(=O)N1CCN(c2ncccc2N)CC1 |
| InChI | InChI=1S/C11H17N5O4S/c1-20-11(17)14-21(18,19)16-7-5-15(6-8-16)10-9(12)3-2-4-13-10/h2-4H,5-8,12H2,1H3,(H,14,17) |
| InChIKey | KHFBUMDMGVZJFQ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |