C20H22N2O2 — CID 176730718
(2-imidazol-1-yl-1-naphthalen-2-ylethyl) 2-methylbutanoate (PubChem CID 176730718) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (2-imidazol-1-yl-1-naphthalen-2-ylethyl) 2-methylbutanoate.
| Compound Name | (2-imidazol-1-yl-1-naphthalen-2-ylethyl) 2-methylbutanoate |
|---|---|
| PubChem CID | 176730718 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (2-imidazol-1-yl-1-naphthalen-2-ylethyl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC(Cn1ccnc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H22N2O2/c1-3-15(2)20(23)24-19(13-22-11-10-21-14-22)18-9-8-16-6-4-5-7-17(16)12-18/h4-12,14-15,19H,3,13H2,1-2H3 |
| InChIKey | DBQSMBNBWPXDRJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |