About [(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride
[(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride (PubChem CID 71535794) has the molecular formula C23H28ClN3O2
and a molecular weight of 413.95 g/mol. Its IUPAC name is [(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride.
Molecular Properties
| Compound Name | [(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride |
| PubChem CID | 71535794 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | [(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride |
| SMILES | CCCC(CCC)C(=O)O/N=C(/Cn1ccnc1)c1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C23H27N3O2.ClH/c1-3-7-19(8-4-2)23(27)28-25-22(16-26-14-13-24-17-26)21-12-11-18-9-5-6-10-20(18)15-21;/h5-6,9-15,17,19H,3-4,7-8,16H2,1-2H3;1H/b25-22-; |
| InChIKey | UFIVKVGAWGFNIA-SIZUISDESA-N |
| XLogP | 5.62 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride?
The IUPAC name of [(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride (CID 71535794) is [(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride.
What is the SMILES notation for [(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride?
The canonical SMILES for [(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride is CCCC(CCC)C(=O)O/N=C(/Cn1ccnc1)c1ccc2ccccc2c1.Cl.
What is the InChIKey of [(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride?
The InChIKey is UFIVKVGAWGFNIA-SIZUISDESA-N. The full InChI is InChI=1S/C23H27N3O2.ClH/c1-3-7-19(8-4-2)23(27)28-25-22(16-26-14-13-24-17-26)21-12-11-18-9-5-6-10-20(18)15-21;/h5-6,9-15,17,19H,3-4,7-8,16H2,1-2H3;1H/b25-22-;.
What are the key properties of [(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride?
[(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride has a molecular weight of 413.95 g/mol, XLogP of 5.62, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 2-propylpentanoate;hydrochloride is sourced from PubChem (CID 71535794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).