C31H26F4N6O2 — CID 176733985
N-[(4S,5S)-3-[(1S)-1-(cyanoamino)ethyl]-7-ethyl-4-(4-fluorophenyl)-6-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-5-yl]-3-(trifluoromethyl)benzamide (PubChem CID 176733985) has the molecular formula C31H26F4N6O2 and a molecular weight of 590.58 g/mol. Its IUPAC name is N-[(4S,5S)-3-[(1S)-1-(cyanoamino)ethyl]-7-ethyl-4-(4-fluorophenyl)-6-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-5-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(4S,5S)-3-[(1S)-1-(cyanoamino)ethyl]-7-ethyl-4-(4-fluorophenyl)-6-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-5-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 176733985 |
| Molecular Formula | C31H26F4N6O2 |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | N-[(4S,5S)-3-[(1S)-1-(cyanoamino)ethyl]-7-ethyl-4-(4-fluorophenyl)-6-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-5-yl]-3-(trifluoromethyl)benzamide |
| SMILES | CCN1C(=O)[C@@H](NC(=O)c2cccc(C(F)(F)F)c2)[C@@H](c2ccc(F)cc2)c2c([C@H](C)NC#N)nn(-c3ccccc3)c21 |
| InChI | InChI=1S/C31H26F4N6O2/c1-3-40-29-25(26(18(2)37-17-36)39-41(29)23-10-5-4-6-11-23)24(19-12-14-22(32)15-13-19)27(30(40)43)38-28(42)20-8-7-9-21(16-20)31(33,34)35/h4-16,18,24,27,37H,3H2,1-2H3,(H,38,42)/t18-,24-,27-/m0/s1 |
| InChIKey | YQFLIGVZAKRBBT-HNEHEIDXSA-N |
| XLogP | 5.46 |
| TPSA | 103.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|