C30H25F4N7O3 — CID 176757597
N-[(4R,5R)-3-(2-azido-1-hydroxyethyl)-7-ethyl-4-(4-fluorophenyl)-6-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-5-yl]-3-(trifluoromethyl)benzamide (PubChem CID 176757597) has the molecular formula C30H25F4N7O3 and a molecular weight of 607.57 g/mol. Its IUPAC name is N-[(4R,5R)-3-(2-azido-1-hydroxyethyl)-7-ethyl-4-(4-fluorophenyl)-6-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-5-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(4R,5R)-3-(2-azido-1-hydroxyethyl)-7-ethyl-4-(4-fluorophenyl)-6-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-5-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 176757597 |
| Molecular Formula | C30H25F4N7O3 |
| Molecular Weight | 607.57 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | N-[(4R,5R)-3-(2-azido-1-hydroxyethyl)-7-ethyl-4-(4-fluorophenyl)-6-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-5-yl]-3-(trifluoromethyl)benzamide |
| SMILES | CCN1C(=O)[C@H](NC(=O)c2cccc(C(F)(F)F)c2)[C@H](c2ccc(F)cc2)c2c(C(O)CN=[N+]=[N-])nn(-c3ccccc3)c21 |
| InChI | InChI=1S/C30H25F4N7O3/c1-2-40-28-24(25(22(42)16-36-39-35)38-41(28)21-9-4-3-5-10-21)23(17-11-13-20(31)14-12-17)26(29(40)44)37-27(43)18-7-6-8-19(15-18)30(32,33)34/h3-15,22-23,26,42H,2,16H2,1H3,(H,37,43)/t22?,23-,26-/m1/s1 |
| InChIKey | NPNPCLIHGNPLSB-IQIYYKORSA-N |
| XLogP | 5.67 |
| TPSA | 136.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|