C17H23NOSe — CID 176737491
10-methoxy-7-methyl-3-propyl-1,2,4,5-tetrahydro-[1]benzoselenolo[2,3-d]azepine (PubChem CID 176737491) has the molecular formula C17H23NOSe and a molecular weight of 336.34 g/mol. Its IUPAC name is 10-methoxy-7-methyl-3-propyl-1,2,4,5-tetrahydro-[1]benzoselenolo[2,3-d]azepine.
| Compound Name | 10-methoxy-7-methyl-3-propyl-1,2,4,5-tetrahydro-[1]benzoselenolo[2,3-d]azepine |
|---|---|
| PubChem CID | 176737491 |
| Molecular Formula | C17H23NOSe |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 10-methoxy-7-methyl-3-propyl-1,2,4,5-tetrahydro-[1]benzoselenolo[2,3-d]azepine |
| SMILES | CCCN1CCc2[se]c3c(C)ccc(OC)c3c2CC1 |
| InChI | InChI=1S/C17H23NOSe/c1-4-9-18-10-7-13-15(8-11-18)20-17-12(2)5-6-14(19-3)16(13)17/h5-6H,4,7-11H2,1-3H3 |
| InChIKey | URNDUXKGTHLZMD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|