About 1-methyl-5-oxoimidazo[1,2-a]pyrimidine-7-carboxylic acid
1-methyl-5-oxoimidazo[1,2-a]pyrimidine-7-carboxylic acid (PubChem CID 176739480) has the molecular formula C8H7N3O3
and a molecular weight of 193.16 g/mol. Its IUPAC name is 1-methyl-5-oxoimidazo[1,2-a]pyrimidine-7-carboxylic acid.
Analyze 1-methyl-5-oxoimidazo[1,2-a]pyrimidine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-oxoimidazo[1,2-a]pyrimidine-7-carboxylic acid?
The IUPAC name of 1-methyl-5-oxoimidazo[1,2-a]pyrimidine-7-carboxylic acid (CID 176739480) is 1-methyl-5-oxoimidazo[1,2-a]pyrimidine-7-carboxylic acid.
What is the SMILES notation for 1-methyl-5-oxoimidazo[1,2-a]pyrimidine-7-carboxylic acid?
The canonical SMILES for 1-methyl-5-oxoimidazo[1,2-a]pyrimidine-7-carboxylic acid is Cn1ccn2c(=O)cc(C(=O)O)nc12.
What is the InChIKey of 1-methyl-5-oxoimidazo[1,2-a]pyrimidine-7-carboxylic acid?
The InChIKey is ORNADEQLMHKNHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O3/c1-10-2-3-11-6(12)4-5(7(13)14)9-8(10)11/h2-4H,1H3,(H,13,14).
What are the key properties of 1-methyl-5-oxoimidazo[1,2-a]pyrimidine-7-carboxylic acid?
1-methyl-5-oxoimidazo[1,2-a]pyrimidine-7-carboxylic acid has a molecular weight of 193.16 g/mol, XLogP of -0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-oxoimidazo[1,2-a]pyrimidine-7-carboxylic acid is sourced from PubChem (CID 176739480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).