C11H24N2 — CID 176748171
(2R,7R)-1,2,7-trimethyl-4-propan-2-yl-1,4-diazepane (PubChem CID 176748171) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is (2R,7R)-1,2,7-trimethyl-4-propan-2-yl-1,4-diazepane.
| Compound Name | (2R,7R)-1,2,7-trimethyl-4-propan-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 176748171 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | (2R,7R)-1,2,7-trimethyl-4-propan-2-yl-1,4-diazepane |
| SMILES | CC(C)N1CC[C@@H](C)N(C)[C@H](C)C1 |
| InChI | InChI=1S/C11H24N2/c1-9(2)13-7-6-10(3)12(5)11(4)8-13/h9-11H,6-8H2,1-5H3/t10-,11-/m1/s1 |
| InChIKey | ZMCBKWHCNIMQLY-GHMZBOCLSA-N |
| XLogP | 1.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |