C49H49NOSi — CID 176751202
6,8-ditert-butyl-N-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-N-(9,9-dimethylfluoren-2-yl)dibenzofuran-3-amine (PubChem CID 176751202) has the molecular formula C49H49NOSi and a molecular weight of 696.02 g/mol. Its IUPAC name is 6,8-ditert-butyl-N-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-N-(9,9-dimethylfluoren-2-yl)dibenzofuran-3-amine.
| Compound Name | 6,8-ditert-butyl-N-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-N-(9,9-dimethylfluoren-2-yl)dibenzofuran-3-amine |
|---|---|
| PubChem CID | 176751202 |
| Molecular Formula | C49H49NOSi |
| Molecular Weight | 696.02 g/mol |
| Exact Mass | 695.36 |
| IUPAC Name | 6,8-ditert-butyl-N-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-N-(9,9-dimethylfluoren-2-yl)dibenzofuran-3-amine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc3cc(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccc5c(c4)[Si](C)(C)c4ccccc4-5)ccc3c2c1 |
| InChI | InChI=1S/C49H49NOSi/c1-47(2,3)30-25-39-36-23-20-32(28-43(36)51-46(39)42(26-30)48(4,5)6)50(31-19-22-35-34-15-11-13-17-40(34)49(7,8)41(35)27-31)33-21-24-38-37-16-12-14-18-44(37)52(9,10)45(38)29-33/h11-29H,1-10H3 |
| InChIKey | BOWSBKKISGKSMM-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.02 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|