C46H26O2 — CID 176751671
11-(1,2,3,4,5,6,7,8-octadeuterio-10-phenanthren-9-ylanthracen-9-yl)-9,20-dioxapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3,5,7,10,12,14,16,18-nonaene (PubChem CID 176751671) has the molecular formula C46H26O2 and a molecular weight of 618.76 g/mol. Its IUPAC name is 11-(1,2,3,4,5,6,7,8-octadeuterio-10-phenanthren-9-ylanthracen-9-yl)-9,20-dioxapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3,5,7,10,12,14,16,18-nonaene.
| Compound Name | 11-(1,2,3,4,5,6,7,8-octadeuterio-10-phenanthren-9-ylanthracen-9-yl)-9,20-dioxapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3,5,7,10,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 176751671 |
| Molecular Formula | C46H26O2 |
| Molecular Weight | 618.76 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | 11-(1,2,3,4,5,6,7,8-octadeuterio-10-phenanthren-9-ylanthracen-9-yl)-9,20-dioxapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3,5,7,10,12,14,16,18-nonaene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cc4c5ccccc5oc4c4c3oc3ccccc34)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3cc4ccccc4c4ccccc34)c2c1[2H] |
| InChI | InChI=1S/C46H26O2/c1-2-14-28-27(13-1)25-37(30-16-4-3-15-29(28)30)42-32-18-5-7-20-34(32)43(35-21-8-6-19-33(35)42)39-26-38-31-17-9-11-23-40(31)47-45(38)44-36-22-10-12-24-41(36)48-46(39)44/h1-26H/i5D,6D,7D,8D,18D,19D,20D,21D |
| InChIKey | ICOQNLGBIOWGPZ-GFVCCLTGSA-N |
| XLogP | 13.43 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.76 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|