C32H31BrIN — CID 176751677
N-(4-bromo-3-iodophenyl)-5,5,8,8-tetramethyl-N-(2-phenylphenyl)-6,7-dihydronaphthalen-2-amine (PubChem CID 176751677) has the molecular formula C32H31BrIN and a molecular weight of 636.42 g/mol. Its IUPAC name is N-(4-bromo-3-iodophenyl)-5,5,8,8-tetramethyl-N-(2-phenylphenyl)-6,7-dihydronaphthalen-2-amine.
| Compound Name | N-(4-bromo-3-iodophenyl)-5,5,8,8-tetramethyl-N-(2-phenylphenyl)-6,7-dihydronaphthalen-2-amine |
|---|---|
| PubChem CID | 176751677 |
| Molecular Formula | C32H31BrIN |
| Molecular Weight | 636.42 g/mol |
| Exact Mass | 635.07 |
| IUPAC Name | N-(4-bromo-3-iodophenyl)-5,5,8,8-tetramethyl-N-(2-phenylphenyl)-6,7-dihydronaphthalen-2-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(N(c3ccc(Br)c(I)c3)c3ccccc3-c3ccccc3)ccc21 |
| InChI | InChI=1S/C32H31BrIN/c1-31(2)18-19-32(3,4)27-20-23(14-16-26(27)31)35(24-15-17-28(33)29(34)21-24)30-13-9-8-12-25(30)22-10-6-5-7-11-22/h5-17,20-21H,18-19H2,1-4H3 |
| InChIKey | ROEQZBKFRPNBTO-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.42 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|