C23H24FN7O2 — CID 176755241
[6-amino-5-(3-hydroxy-2,6-dimethylphenyl)-2,3-dimethylpyrrolo[2,3-b]pyrazin-7-yl]-(3-fluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)methanone (PubChem CID 176755241) has the molecular formula C23H24FN7O2 and a molecular weight of 449.49 g/mol. Its IUPAC name is [6-amino-5-(3-hydroxy-2,6-dimethylphenyl)-2,3-dimethylpyrrolo[2,3-b]pyrazin-7-yl]-(3-fluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)methanone.
| Compound Name | [6-amino-5-(3-hydroxy-2,6-dimethylphenyl)-2,3-dimethylpyrrolo[2,3-b]pyrazin-7-yl]-(3-fluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)methanone |
|---|---|
| PubChem CID | 176755241 |
| Molecular Formula | C23H24FN7O2 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [6-amino-5-(3-hydroxy-2,6-dimethylphenyl)-2,3-dimethylpyrrolo[2,3-b]pyrazin-7-yl]-(3-fluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)methanone |
| SMILES | Cc1ccc(O)c(C)c1-n1c(N)c(C(=O)N2CCn3ncc(F)c3C2)c2nc(C)c(C)nc21 |
| InChI | InChI=1S/C23H24FN7O2/c1-11-5-6-17(32)12(2)20(11)31-21(25)18(19-22(31)28-14(4)13(3)27-19)23(33)29-7-8-30-16(10-29)15(24)9-26-30/h5-6,9,32H,7-8,10,25H2,1-4H3 |
| InChIKey | WIKGWGPDBSAKOZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |