C17H15ClN4O — CID 176755299
5-chloro-3-isocyano-1-(3-methoxy-2,6-dimethylphenyl)pyrrolo[2,3-b]pyridin-2-amine (PubChem CID 176755299) has the molecular formula C17H15ClN4O and a molecular weight of 326.79 g/mol. Its IUPAC name is 5-chloro-3-isocyano-1-(3-methoxy-2,6-dimethylphenyl)pyrrolo[2,3-b]pyridin-2-amine.
| Compound Name | 5-chloro-3-isocyano-1-(3-methoxy-2,6-dimethylphenyl)pyrrolo[2,3-b]pyridin-2-amine |
|---|---|
| PubChem CID | 176755299 |
| Molecular Formula | C17H15ClN4O |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 5-chloro-3-isocyano-1-(3-methoxy-2,6-dimethylphenyl)pyrrolo[2,3-b]pyridin-2-amine |
| SMILES | [C-]#[N+]c1c(N)n(-c2c(C)ccc(OC)c2C)c2ncc(Cl)cc12 |
| InChI | InChI=1S/C17H15ClN4O/c1-9-5-6-13(23-4)10(2)15(9)22-16(19)14(20-3)12-7-11(18)8-21-17(12)22/h5-8H,19H2,1-2,4H3 |
| InChIKey | PQHMYZDRXHLEJN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|