C20H39N3 — CID 176760528
4-tert-butyl-1-[(1-piperidin-4-ylpiperidin-4-yl)methyl]piperidine (PubChem CID 176760528) has the molecular formula C20H39N3 and a molecular weight of 321.55 g/mol. Its IUPAC name is 4-tert-butyl-1-[(1-piperidin-4-ylpiperidin-4-yl)methyl]piperidine.
| Compound Name | 4-tert-butyl-1-[(1-piperidin-4-ylpiperidin-4-yl)methyl]piperidine |
|---|---|
| PubChem CID | 176760528 |
| Molecular Formula | C20H39N3 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.31 |
| IUPAC Name | 4-tert-butyl-1-[(1-piperidin-4-ylpiperidin-4-yl)methyl]piperidine |
| SMILES | CC(C)(C)C1CCN(CC2CCN(C3CCNCC3)CC2)CC1 |
| InChI | InChI=1S/C20H39N3/c1-20(2,3)18-8-12-22(13-9-18)16-17-6-14-23(15-7-17)19-4-10-21-11-5-19/h17-19,21H,4-16H2,1-3H3 |
| InChIKey | CVBPQHMJAQBGMT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |