C21H40N4O2 — CID 163378049
tert-butyl 2-[4-[(4-piperazin-1-ylpiperidin-1-yl)methyl]piperidin-1-yl]acetate (PubChem CID 163378049) has the molecular formula C21H40N4O2 and a molecular weight of 380.58 g/mol. Its IUPAC name is tert-butyl 2-[4-[(4-piperazin-1-ylpiperidin-1-yl)methyl]piperidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[(4-piperazin-1-ylpiperidin-1-yl)methyl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 163378049 |
| Molecular Formula | C21H40N4O2 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | tert-butyl 2-[4-[(4-piperazin-1-ylpiperidin-1-yl)methyl]piperidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCC(CN2CCC(N3CCNCC3)CC2)CC1 |
| InChI | InChI=1S/C21H40N4O2/c1-21(2,3)27-20(26)17-24-10-4-18(5-11-24)16-23-12-6-19(7-13-23)25-14-8-22-9-15-25/h18-19,22H,4-17H2,1-3H3 |
| InChIKey | QJCAAEJTEVVNKM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |