C23H45N5O2 — CID 172511665
N-tert-butyl-2-[2-[4-[(4-piperazin-1-ylpiperidin-1-yl)methyl]piperidin-1-yl]ethoxy]acetamide (PubChem CID 172511665) has the molecular formula C23H45N5O2 and a molecular weight of 423.65 g/mol. Its IUPAC name is N-tert-butyl-2-[2-[4-[(4-piperazin-1-ylpiperidin-1-yl)methyl]piperidin-1-yl]ethoxy]acetamide.
| Compound Name | N-tert-butyl-2-[2-[4-[(4-piperazin-1-ylpiperidin-1-yl)methyl]piperidin-1-yl]ethoxy]acetamide |
|---|---|
| PubChem CID | 172511665 |
| Molecular Formula | C23H45N5O2 |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.36 |
| IUPAC Name | N-tert-butyl-2-[2-[4-[(4-piperazin-1-ylpiperidin-1-yl)methyl]piperidin-1-yl]ethoxy]acetamide |
| SMILES | CC(C)(C)NC(=O)COCCN1CCC(CN2CCC(N3CCNCC3)CC2)CC1 |
| InChI | InChI=1S/C23H45N5O2/c1-23(2,3)25-22(29)19-30-17-16-26-10-4-20(5-11-26)18-27-12-6-21(7-13-27)28-14-8-24-9-15-28/h20-21,24H,4-19H2,1-3H3,(H,25,29) |
| InChIKey | KNJAZKKIQIWCIN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|