C26H25ClF2N6O2 — CID 176761216
2-N-[3-[(1S,2S,3S)-2-chloro-3-(dimethylamino)-1-methoxycyclobutyl]oxyphenyl]-4-N-(6,7-difluoroquinolin-3-yl)pyrimidine-2,4-diamine (PubChem CID 176761216) has the molecular formula C26H25ClF2N6O2 and a molecular weight of 526.98 g/mol. Its IUPAC name is 2-N-[3-[(1S,2S,3S)-2-chloro-3-(dimethylamino)-1-methoxycyclobutyl]oxyphenyl]-4-N-(6,7-difluoroquinolin-3-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-[(1S,2S,3S)-2-chloro-3-(dimethylamino)-1-methoxycyclobutyl]oxyphenyl]-4-N-(6,7-difluoroquinolin-3-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 176761216 |
| Molecular Formula | C26H25ClF2N6O2 |
| Molecular Weight | 526.98 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 2-N-[3-[(1S,2S,3S)-2-chloro-3-(dimethylamino)-1-methoxycyclobutyl]oxyphenyl]-4-N-(6,7-difluoroquinolin-3-yl)pyrimidine-2,4-diamine |
| SMILES | CO[C@]1(Oc2cccc(Nc3nccc(Nc4cnc5cc(F)c(F)cc5c4)n3)c2)C[C@H](N(C)C)[C@@H]1Cl |
| InChI | InChI=1S/C26H25ClF2N6O2/c1-35(2)22-13-26(36-3,24(22)27)37-18-6-4-5-16(11-18)33-25-30-8-7-23(34-25)32-17-9-15-10-19(28)20(29)12-21(15)31-14-17/h4-12,14,22,24H,13H2,1-3H3,(H2,30,32,33,34)/t22-,24-,26-/m0/s1 |
| InChIKey | AJHWZCIMXYOMMR-GVUKDKGQSA-N |
| XLogP | 5.45 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.98 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|