C26H26F2N6O2 — CID 176761245
4-N-(5,6-difluoroquinolin-3-yl)-2-N-[4-[3-(dimethylamino)-3-methoxycyclobutyl]oxyphenyl]pyrimidine-2,4-diamine (PubChem CID 176761245) has the molecular formula C26H26F2N6O2 and a molecular weight of 492.53 g/mol. Its IUPAC name is 4-N-(5,6-difluoroquinolin-3-yl)-2-N-[4-[3-(dimethylamino)-3-methoxycyclobutyl]oxyphenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(5,6-difluoroquinolin-3-yl)-2-N-[4-[3-(dimethylamino)-3-methoxycyclobutyl]oxyphenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 176761245 |
| Molecular Formula | C26H26F2N6O2 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 4-N-(5,6-difluoroquinolin-3-yl)-2-N-[4-[3-(dimethylamino)-3-methoxycyclobutyl]oxyphenyl]pyrimidine-2,4-diamine |
| SMILES | COC1(N(C)C)CC(Oc2ccc(Nc3nccc(Nc4cnc5ccc(F)c(F)c5c4)n3)cc2)C1 |
| InChI | InChI=1S/C26H26F2N6O2/c1-34(2)26(35-3)13-19(14-26)36-18-6-4-16(5-7-18)32-25-29-11-10-23(33-25)31-17-12-20-22(30-15-17)9-8-21(27)24(20)28/h4-12,15,19H,13-14H2,1-3H3,(H2,29,31,32,33) |
| InChIKey | VRDJKAFYZFQEOO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|