C29H30FN7O5 — CID 176762526
6-fluoro-11-[[(2-methoxy-4-pyridinyl)methyl-[(3S)-1-(6-nitro-3-pyridinyl)piperidin-3-yl]amino]methyl]-2-methyl-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one (PubChem CID 176762526) has the molecular formula C29H30FN7O5 and a molecular weight of 575.60 g/mol. Its IUPAC name is 6-fluoro-11-[[(2-methoxy-4-pyridinyl)methyl-[(3S)-1-(6-nitro-3-pyridinyl)piperidin-3-yl]amino]methyl]-2-methyl-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one.
| Compound Name | 6-fluoro-11-[[(2-methoxy-4-pyridinyl)methyl-[(3S)-1-(6-nitro-3-pyridinyl)piperidin-3-yl]amino]methyl]-2-methyl-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one |
|---|---|
| PubChem CID | 176762526 |
| Molecular Formula | C29H30FN7O5 |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 6-fluoro-11-[[(2-methoxy-4-pyridinyl)methyl-[(3S)-1-(6-nitro-3-pyridinyl)piperidin-3-yl]amino]methyl]-2-methyl-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one |
| SMILES | COc1cc(CN(Cc2cn3c4c(c(F)cnc4c2=O)OCC3C)[C@H]2CCCN(c3ccc([N+](=O)[O-])nc3)C2)ccn1 |
| InChI | InChI=1S/C29H30FN7O5/c1-18-17-42-29-23(30)12-33-26-27(29)36(18)15-20(28(26)38)14-35(13-19-7-8-31-25(10-19)41-2)22-4-3-9-34(16-22)21-5-6-24(32-11-21)37(39)40/h5-8,10-12,15,18,22H,3-4,9,13-14,16-17H2,1-2H3/t18?,22-/m0/s1 |
| InChIKey | LUOALWFOAIXJBO-YSYXNDDBSA-N |
| XLogP | 3.87 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|