C28H26F2N6O5 — CID 176762537
5,6-difluoro-10-[[(2-methoxy-4-pyridinyl)methyl-[(3S)-1-(6-nitro-3-pyridinyl)piperidin-3-yl]amino]methyl]-3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-one (PubChem CID 176762537) has the molecular formula C28H26F2N6O5 and a molecular weight of 564.55 g/mol. Its IUPAC name is 5,6-difluoro-10-[[(2-methoxy-4-pyridinyl)methyl-[(3S)-1-(6-nitro-3-pyridinyl)piperidin-3-yl]amino]methyl]-3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-one.
| Compound Name | 5,6-difluoro-10-[[(2-methoxy-4-pyridinyl)methyl-[(3S)-1-(6-nitro-3-pyridinyl)piperidin-3-yl]amino]methyl]-3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-one |
|---|---|
| PubChem CID | 176762537 |
| Molecular Formula | C28H26F2N6O5 |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 5,6-difluoro-10-[[(2-methoxy-4-pyridinyl)methyl-[(3S)-1-(6-nitro-3-pyridinyl)piperidin-3-yl]amino]methyl]-3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-one |
| SMILES | COc1cc(CN(Cc2cn3c4c(c(F)c(F)cc4c2=O)OC3)[C@H]2CCCN(c3ccc([N+](=O)[O-])nc3)C2)ccn1 |
| InChI | InChI=1S/C28H26F2N6O5/c1-40-24-9-17(6-7-31-24)12-34(20-3-2-8-33(15-20)19-4-5-23(32-11-19)36(38)39)13-18-14-35-16-41-28-25(30)22(29)10-21(26(28)35)27(18)37/h4-7,9-11,14,20H,2-3,8,12-13,15-16H2,1H3/t20-/m0/s1 |
| InChIKey | WYRQUJVHBVAYHT-FQEVSTJZSA-N |
| XLogP | 4.01 |
| TPSA | 115.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|