C33H45N7O4 — CID 176767267
4-[[6-(2-hydroxypropan-2-yl)-2-pyridinyl]amino]-2-[4-[9-methoxynonanoyl(methyl)amino]anilino]-N-prop-2-enylpyrimidine-5-carboxamide (PubChem CID 176767267) has the molecular formula C33H45N7O4 and a molecular weight of 603.77 g/mol. Its IUPAC name is 4-[[6-(2-hydroxypropan-2-yl)-2-pyridinyl]amino]-2-[4-[9-methoxynonanoyl(methyl)amino]anilino]-N-prop-2-enylpyrimidine-5-carboxamide.
| Compound Name | 4-[[6-(2-hydroxypropan-2-yl)-2-pyridinyl]amino]-2-[4-[9-methoxynonanoyl(methyl)amino]anilino]-N-prop-2-enylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 176767267 |
| Molecular Formula | C33H45N7O4 |
| Molecular Weight | 603.77 g/mol |
| Exact Mass | 603.35 |
| IUPAC Name | 4-[[6-(2-hydroxypropan-2-yl)-2-pyridinyl]amino]-2-[4-[9-methoxynonanoyl(methyl)amino]anilino]-N-prop-2-enylpyrimidine-5-carboxamide |
| SMILES | C=CCNC(=O)c1cnc(Nc2ccc(N(C)C(=O)CCCCCCCCOC)cc2)nc1Nc1cccc(C(C)(C)O)n1 |
| InChI | InChI=1S/C33H45N7O4/c1-6-21-34-31(42)26-23-35-32(39-30(26)38-28-15-13-14-27(37-28)33(2,3)43)36-24-17-19-25(20-18-24)40(4)29(41)16-11-9-7-8-10-12-22-44-5/h6,13-15,17-20,23,43H,1,7-12,16,21-22H2,2-5H3,(H,34,42)(H2,35,36,37,38,39) |
| InChIKey | DBDWUCXUBVUSFV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 141.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.77 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|