C39H34ClNO8S — CID 176768111
[4-(4-acetylcyclohexanecarbonyl)oxy-3-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]phenyl] 4-[(4-acetylphenyl)-methylcarbamoyl]benzoate (PubChem CID 176768111) has the molecular formula C39H34ClNO8S and a molecular weight of 712.22 g/mol. Its IUPAC name is [4-(4-acetylcyclohexanecarbonyl)oxy-3-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]phenyl] 4-[(4-acetylphenyl)-methylcarbamoyl]benzoate.
| Compound Name | [4-(4-acetylcyclohexanecarbonyl)oxy-3-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]phenyl] 4-[(4-acetylphenyl)-methylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 176768111 |
| Molecular Formula | C39H34ClNO8S |
| Molecular Weight | 712.22 g/mol |
| Exact Mass | 711.17 |
| IUPAC Name | [4-(4-acetylcyclohexanecarbonyl)oxy-3-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]phenyl] 4-[(4-acetylphenyl)-methylcarbamoyl]benzoate |
| SMILES | CC(=O)c1ccc(N(C)C(=O)c2ccc(C(=O)Oc3ccc(OC(=O)C4CCC(C(C)=O)CC4)c(/C=C/C(=O)c4ccc(Cl)s4)c3)cc2)cc1 |
| InChI | InChI=1S/C39H34ClNO8S/c1-23(42)25-4-8-29(9-5-25)39(47)49-34-19-17-32(22-30(34)14-18-33(44)35-20-21-36(40)50-35)48-38(46)28-10-6-27(7-11-28)37(45)41(3)31-15-12-26(13-16-31)24(2)43/h6-7,10-22,25,29H,4-5,8-9H2,1-3H3/b18-14+ |
| InChIKey | VMGWXJMQDZTLEK-NBVRZTHBSA-N |
| XLogP | 8.30 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.22 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|