C47H63ClO9S — CID 176768128
4-O-[2-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]-4-methoxyphenyl] 1-O-[4-[4-[4-(4-methoxycyclohexyl)cyclohexyl]peroxycyclohexyl]cyclohexyl] cyclohexane-1,4-dicarboxylate (PubChem CID 176768128) has the molecular formula C47H63ClO9S and a molecular weight of 839.53 g/mol. Its IUPAC name is 4-O-[2-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]-4-methoxyphenyl] 1-O-[4-[4-[4-(4-methoxycyclohexyl)cyclohexyl]peroxycyclohexyl]cyclohexyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[2-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]-4-methoxyphenyl] 1-O-[4-[4-[4-(4-methoxycyclohexyl)cyclohexyl]peroxycyclohexyl]cyclohexyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 176768128 |
| Molecular Formula | C47H63ClO9S |
| Molecular Weight | 839.53 g/mol |
| Exact Mass | 838.39 |
| IUPAC Name | 4-O-[2-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]-4-methoxyphenyl] 1-O-[4-[4-[4-(4-methoxycyclohexyl)cyclohexyl]peroxycyclohexyl]cyclohexyl] cyclohexane-1,4-dicarboxylate |
| SMILES | COc1ccc(OC(=O)C2CCC(C(=O)OC3CCC(C4CCC(OOC5CCC(C6CCC(OC)CC6)CC5)CC4)CC3)CC2)c(/C=C/C(=O)c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C47H63ClO9S/c1-52-37-16-7-30(8-17-37)32-11-20-39(21-12-32)56-57-40-22-13-33(14-23-40)31-9-18-38(19-10-31)54-46(50)34-3-5-35(6-4-34)47(51)55-43-26-24-41(53-2)29-36(43)15-25-42(49)44-27-28-45(48)58-44/h15,24-35,37-40H,3-14,16-23H2,1-2H3/b25-15+ |
| InChIKey | SWDFSXNJOAMTNY-MFKUBSTISA-N |
| XLogP | 11.39 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.53 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|