C31H32O7S — CID 176768207
1-O-[4-(2-methoxyethyl)phenyl] 4-O-[4-methoxy-2-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 176768207) has the molecular formula C31H32O7S and a molecular weight of 548.66 g/mol. Its IUPAC name is 1-O-[4-(2-methoxyethyl)phenyl] 4-O-[4-methoxy-2-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 1-O-[4-(2-methoxyethyl)phenyl] 4-O-[4-methoxy-2-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 176768207 |
| Molecular Formula | C31H32O7S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | 1-O-[4-(2-methoxyethyl)phenyl] 4-O-[4-methoxy-2-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | COCCc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OC)cc3/C=C/C(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C31H32O7S/c1-35-18-17-21-5-12-25(13-6-21)37-30(33)22-7-9-23(10-8-22)31(34)38-28-16-14-26(36-2)20-24(28)11-15-27(32)29-4-3-19-39-29/h3-6,11-16,19-20,22-23H,7-10,17-18H2,1-2H3/b15-11+ |
| InChIKey | XIWJVNQRHZXVPC-RVDMUPIBSA-N |
| XLogP | 6.16 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|