C21H15N7O2S — CID 176768333
2-[4-[[5-amino-1-(6-isocyanonaphthalen-1-yl)sulfonyl-1,2,4-triazol-3-yl]amino]phenyl]acetonitrile (PubChem CID 176768333) has the molecular formula C21H15N7O2S and a molecular weight of 429.47 g/mol. Its IUPAC name is 2-[4-[[5-amino-1-(6-isocyanonaphthalen-1-yl)sulfonyl-1,2,4-triazol-3-yl]amino]phenyl]acetonitrile.
| Compound Name | 2-[4-[[5-amino-1-(6-isocyanonaphthalen-1-yl)sulfonyl-1,2,4-triazol-3-yl]amino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 176768333 |
| Molecular Formula | C21H15N7O2S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 2-[4-[[5-amino-1-(6-isocyanonaphthalen-1-yl)sulfonyl-1,2,4-triazol-3-yl]amino]phenyl]acetonitrile |
| SMILES | [C-]#[N+]c1ccc2c(S(=O)(=O)n3nc(Nc4ccc(CC#N)cc4)nc3N)cccc2c1 |
| InChI | InChI=1S/C21H15N7O2S/c1-24-17-9-10-18-15(13-17)3-2-4-19(18)31(29,30)28-20(23)26-21(27-28)25-16-7-5-14(6-8-16)11-12-22/h2-10,13H,11H2,(H3,23,25,26,27) |
| InChIKey | ZSKLYBMUASAATI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 131.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|