C22H15F2N5O2 — CID 176769788
1-[[4-[4-[(2,6-difluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]phenyl]methyl]-5-isocyanopyridin-2-one (PubChem CID 176769788) has the molecular formula C22H15F2N5O2 and a molecular weight of 419.39 g/mol. Its IUPAC name is 1-[[4-[4-[(2,6-difluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]phenyl]methyl]-5-isocyanopyridin-2-one.
| Compound Name | 1-[[4-[4-[(2,6-difluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]phenyl]methyl]-5-isocyanopyridin-2-one |
|---|---|
| PubChem CID | 176769788 |
| Molecular Formula | C22H15F2N5O2 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 1-[[4-[4-[(2,6-difluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]phenyl]methyl]-5-isocyanopyridin-2-one |
| SMILES | [C-]#[N+]c1ccc(=O)n(Cc2ccc(-n3ncn(Cc4c(F)cccc4F)c3=O)cc2)c1 |
| InChI | InChI=1S/C22H15F2N5O2/c1-25-16-7-10-21(30)27(12-16)11-15-5-8-17(9-6-15)29-22(31)28(14-26-29)13-18-19(23)3-2-4-20(18)24/h2-10,12,14H,11,13H2 |
| InChIKey | DRPBNXUYHMXXPD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|