C22H18ClN5O3S — CID 176770071
5-[2-chloro-4-[(5S)-3-oxo-5-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-2-yl]phenoxy]-4-methyl-1,3-thiazole-2-carboxamide (PubChem CID 176770071) has the molecular formula C22H18ClN5O3S and a molecular weight of 467.94 g/mol. Its IUPAC name is 5-[2-chloro-4-[(5S)-3-oxo-5-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-2-yl]phenoxy]-4-methyl-1,3-thiazole-2-carboxamide.
| Compound Name | 5-[2-chloro-4-[(5S)-3-oxo-5-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-2-yl]phenoxy]-4-methyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 176770071 |
| Molecular Formula | C22H18ClN5O3S |
| Molecular Weight | 467.94 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 5-[2-chloro-4-[(5S)-3-oxo-5-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-2-yl]phenoxy]-4-methyl-1,3-thiazole-2-carboxamide |
| SMILES | Cc1nc(C(N)=O)sc1Oc1ccc(-n2nc3n(c2=O)[C@H](c2ccccc2)CC3)cc1Cl |
| InChI | InChI=1S/C22H18ClN5O3S/c1-12-21(32-20(25-12)19(24)29)31-17-9-7-14(11-15(17)23)28-22(30)27-16(8-10-18(27)26-28)13-5-3-2-4-6-13/h2-7,9,11,16H,8,10H2,1H3,(H2,24,29)/t16-/m0/s1 |
| InChIKey | XZHABWPTGAJIGP-INIZCTEOSA-N |
| XLogP | 3.88 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.94 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |