C18H16ClN3O2 — CID 50742914
benzyl 1-(3-chloro-4-methylphenyl)-5-methyltriazole-4-carboxylate (PubChem CID 50742914) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is benzyl 1-(3-chloro-4-methylphenyl)-5-methyltriazole-4-carboxylate.
| Compound Name | benzyl 1-(3-chloro-4-methylphenyl)-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 50742914 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | benzyl 1-(3-chloro-4-methylphenyl)-5-methyltriazole-4-carboxylate |
| SMILES | Cc1ccc(-n2nnc(C(=O)OCc3ccccc3)c2C)cc1Cl |
| InChI | InChI=1S/C18H16ClN3O2/c1-12-8-9-15(10-16(12)19)22-13(2)17(20-21-22)18(23)24-11-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3 |
| InChIKey | WMHHYOAAKKYAIY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |