C29H22ClN3O3 — CID 176772981
4-[[[1-[(3-chlorophenyl)methyl]-5-phenylindazole-7-carbonyl]amino]methyl]benzoic acid (PubChem CID 176772981) has the molecular formula C29H22ClN3O3 and a molecular weight of 495.97 g/mol. Its IUPAC name is 4-[[[1-[(3-chlorophenyl)methyl]-5-phenylindazole-7-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[1-[(3-chlorophenyl)methyl]-5-phenylindazole-7-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 176772981 |
| Molecular Formula | C29H22ClN3O3 |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 4-[[[1-[(3-chlorophenyl)methyl]-5-phenylindazole-7-carbonyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2cc(-c3ccccc3)cc3cnn(Cc4cccc(Cl)c4)c23)cc1 |
| InChI | InChI=1S/C29H22ClN3O3/c30-25-8-4-5-20(13-25)18-33-27-24(17-32-33)14-23(21-6-2-1-3-7-21)15-26(27)28(34)31-16-19-9-11-22(12-10-19)29(35)36/h1-15,17H,16,18H2,(H,31,34)(H,35,36) |
| InChIKey | VAPCQWPDIMRQIM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |