C31H26Cl2N3O4P — CID 176772393
4-[[[1-[(3,5-dichlorophenyl)methyl]-5-(3-dimethylphosphorylphenyl)indazole-7-carbonyl]amino]methyl]benzoic acid (PubChem CID 176772393) has the molecular formula C31H26Cl2N3O4P and a molecular weight of 606.45 g/mol. Its IUPAC name is 4-[[[1-[(3,5-dichlorophenyl)methyl]-5-(3-dimethylphosphorylphenyl)indazole-7-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[1-[(3,5-dichlorophenyl)methyl]-5-(3-dimethylphosphorylphenyl)indazole-7-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 176772393 |
| Molecular Formula | C31H26Cl2N3O4P |
| Molecular Weight | 606.45 g/mol |
| Exact Mass | 605.10 |
| IUPAC Name | 4-[[[1-[(3,5-dichlorophenyl)methyl]-5-(3-dimethylphosphorylphenyl)indazole-7-carbonyl]amino]methyl]benzoic acid |
| SMILES | CP(C)(=O)c1cccc(-c2cc(C(=O)NCc3ccc(C(=O)O)cc3)c3c(cnn3Cc3cc(Cl)cc(Cl)c3)c2)c1 |
| InChI | InChI=1S/C31H26Cl2N3O4P/c1-41(2,40)27-5-3-4-22(13-27)23-12-24-17-35-36(18-20-10-25(32)15-26(33)11-20)29(24)28(14-23)30(37)34-16-19-6-8-21(9-7-19)31(38)39/h3-15,17H,16,18H2,1-2H3,(H,34,37)(H,38,39) |
| InChIKey | PGCZPJZIEURUKR-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.45 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|