C37H32N3O4P — CID 176772037
4-[[[5-(3-dimethylphosphorylphenyl)-1-[(6-phenyl-3-pyridinyl)methyl]indole-7-carbonyl]amino]methyl]benzoic acid (PubChem CID 176772037) has the molecular formula C37H32N3O4P and a molecular weight of 613.65 g/mol. Its IUPAC name is 4-[[[5-(3-dimethylphosphorylphenyl)-1-[(6-phenyl-3-pyridinyl)methyl]indole-7-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[5-(3-dimethylphosphorylphenyl)-1-[(6-phenyl-3-pyridinyl)methyl]indole-7-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 176772037 |
| Molecular Formula | C37H32N3O4P |
| Molecular Weight | 613.65 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | 4-[[[5-(3-dimethylphosphorylphenyl)-1-[(6-phenyl-3-pyridinyl)methyl]indole-7-carbonyl]amino]methyl]benzoic acid |
| SMILES | CP(C)(=O)c1cccc(-c2cc(C(=O)NCc3ccc(C(=O)O)cc3)c3c(ccn3Cc3ccc(-c4ccccc4)nc3)c2)c1 |
| InChI | InChI=1S/C37H32N3O4P/c1-45(2,44)32-10-6-9-29(20-32)31-19-30-17-18-40(24-26-13-16-34(38-23-26)27-7-4-3-5-8-27)35(30)33(21-31)36(41)39-22-25-11-14-28(15-12-25)37(42)43/h3-21,23H,22,24H2,1-2H3,(H,39,41)(H,42,43) |
| InChIKey | BTHRAGMKNMBDOL-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.65 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|