C40H35N2O4P — CID 176771774
4-[1-[[5-(3-dimethylphosphorylphenyl)-1-[(4-phenylphenyl)methyl]indole-7-carbonyl]amino]cyclopropyl]benzoic acid (PubChem CID 176771774) has the molecular formula C40H35N2O4P and a molecular weight of 638.70 g/mol. Its IUPAC name is 4-[1-[[5-(3-dimethylphosphorylphenyl)-1-[(4-phenylphenyl)methyl]indole-7-carbonyl]amino]cyclopropyl]benzoic acid.
| Compound Name | 4-[1-[[5-(3-dimethylphosphorylphenyl)-1-[(4-phenylphenyl)methyl]indole-7-carbonyl]amino]cyclopropyl]benzoic acid |
|---|---|
| PubChem CID | 176771774 |
| Molecular Formula | C40H35N2O4P |
| Molecular Weight | 638.70 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | 4-[1-[[5-(3-dimethylphosphorylphenyl)-1-[(4-phenylphenyl)methyl]indole-7-carbonyl]amino]cyclopropyl]benzoic acid |
| SMILES | CP(C)(=O)c1cccc(-c2cc(C(=O)NC3(c4ccc(C(=O)O)cc4)CC3)c3c(ccn3Cc3ccc(-c4ccccc4)cc3)c2)c1 |
| InChI | InChI=1S/C40H35N2O4P/c1-47(2,46)35-10-6-9-31(24-35)33-23-32-19-22-42(26-27-11-13-29(14-12-27)28-7-4-3-5-8-28)37(32)36(25-33)38(43)41-40(20-21-40)34-17-15-30(16-18-34)39(44)45/h3-19,22-25H,20-21,26H2,1-2H3,(H,41,43)(H,44,45) |
| InChIKey | DCPKVQTZELAOGY-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.70 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|