C33H28F3N2O4P — CID 176772063
4-[[[5-(3-dimethylphosphorylphenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole-7-carbonyl]amino]methyl]benzoic acid (PubChem CID 176772063) has the molecular formula C33H28F3N2O4P and a molecular weight of 604.57 g/mol. Its IUPAC name is 4-[[[5-(3-dimethylphosphorylphenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole-7-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[5-(3-dimethylphosphorylphenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole-7-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 176772063 |
| Molecular Formula | C33H28F3N2O4P |
| Molecular Weight | 604.57 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | 4-[[[5-(3-dimethylphosphorylphenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole-7-carbonyl]amino]methyl]benzoic acid |
| SMILES | CP(C)(=O)c1cccc(-c2cc(C(=O)NCc3ccc(C(=O)O)cc3)c3c(ccn3Cc3ccc(C(F)(F)F)cc3)c2)c1 |
| InChI | InChI=1S/C33H28F3N2O4P/c1-43(2,42)28-5-3-4-24(17-28)26-16-25-14-15-38(20-22-8-12-27(13-9-22)33(34,35)36)30(25)29(18-26)31(39)37-19-21-6-10-23(11-7-21)32(40)41/h3-18H,19-20H2,1-2H3,(H,37,39)(H,40,41) |
| InChIKey | AQCJVIBQOUKSQY-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.57 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|