C25H21ClN2O4 — CID 58306903
4-[[[1-[(4-chlorophenyl)methyl]-5-methoxyindole-7-carbonyl]amino]methyl]benzoic acid (PubChem CID 58306903) has the molecular formula C25H21ClN2O4 and a molecular weight of 448.91 g/mol. Its IUPAC name is 4-[[[1-[(4-chlorophenyl)methyl]-5-methoxyindole-7-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[1-[(4-chlorophenyl)methyl]-5-methoxyindole-7-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 58306903 |
| Molecular Formula | C25H21ClN2O4 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 4-[[[1-[(4-chlorophenyl)methyl]-5-methoxyindole-7-carbonyl]amino]methyl]benzoic acid |
| SMILES | COc1cc(C(=O)NCc2ccc(C(=O)O)cc2)c2c(ccn2Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C25H21ClN2O4/c1-32-21-12-19-10-11-28(15-17-4-8-20(26)9-5-17)23(19)22(13-21)24(29)27-14-16-2-6-18(7-3-16)25(30)31/h2-13H,14-15H2,1H3,(H,27,29)(H,30,31) |
| InChIKey | ICRWAUSYBHLFBH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |