C8H14FN3 — CID 176773800
3-fluoro-1,5-di(propan-2-yl)-1,2,4-triazole (PubChem CID 176773800) has the molecular formula C8H14FN3 and a molecular weight of 171.22 g/mol. Its IUPAC name is 3-fluoro-1,5-di(propan-2-yl)-1,2,4-triazole.
| Compound Name | 3-fluoro-1,5-di(propan-2-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 176773800 |
| Molecular Formula | C8H14FN3 |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.12 |
| IUPAC Name | 3-fluoro-1,5-di(propan-2-yl)-1,2,4-triazole |
| SMILES | CC(C)c1nc(F)nn1C(C)C |
| InChI | InChI=1S/C8H14FN3/c1-5(2)7-10-8(9)11-12(7)6(3)4/h5-6H,1-4H3 |
| InChIKey | BILZLVOGGCIFBC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |